EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17N3O4 |
| Net Charge | 0 |
| Average Mass | 291.307 |
| Monoisotopic Mass | 291.12191 |
| SMILES | NCC(=O)N1C[C@H](NC(=O)c2ccccc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C14H17N3O4/c15-7-12(18)17-8-10(6-11(17)14(20)21)16-13(19)9-4-2-1-3-5-9/h1-5,10-11H,6-8,15H2,(H,16,19)(H,20,21)/t10-,11+/m1/s1 |
| InChIKey | BIZKIHUJGMSVFD-MNOVXSKESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| danegaptide (CHEBI:177853) has role anti-arrhythmia drug (CHEBI:38070) |
| danegaptide (CHEBI:177853) has role cardiovascular drug (CHEBI:35554) |
| danegaptide (CHEBI:177853) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S,4R)-1-(2-aminoacetyl)-4-benzamidopyrrolidine-2-carboxylic acid |
| INNs | Source |
|---|---|
| danegaptida | WHO MedNet |
| danegaptide | WHO MedNet |
| Synonyms | Source |
|---|---|
| GAP-134 | ChEMBL |
| ZP-1609 | ChEMBL |
| ZP1609 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:943134-39-2 | ChemIDplus |
| Citations |
|---|