EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30N6O3S |
| Net Charge | 0 |
| Average Mass | 458.588 |
| Monoisotopic Mass | 458.21001 |
| SMILES | CNS(=O)(=O)Cc1ccc2ncc(CCCN3CCN(c4ncncc4OC)CC3)c2c1 |
| InChI | InChI=1S/C22H30N6O3S/c1-23-32(29,30)15-17-5-6-20-19(12-17)18(13-25-20)4-3-7-27-8-10-28(11-9-27)22-21(31-2)14-24-16-26-22/h5-6,12-14,16,23,25H,3-4,7-11,15H2,1-2H3 |
| InChIKey | WRZVGHXUPBWIOO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| avitriptan (CHEBI:177844) is a tryptamines (CHEBI:27162) |
| IUPAC Name |
|---|
| 1-[3-[3-[4-(5-methoxypyrimidin-4-yl)piperazin-1-yl]propyl]-1H-indol-5-yl]-N-methylmethanesulonamide |
| INN | Source |
|---|---|
| avitriptan | WHO MedNet |
| Manual Xrefs | Databases |
|---|---|
| 117442 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:151140-96-4 | ChemIDplus |