EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19N3O3 |
| Net Charge | 0 |
| Average Mass | 241.291 |
| Monoisotopic Mass | 241.14264 |
| SMILES | N[C@@H](CCCCNC(=O)[C@H]1CCC=N1)C(=O)O |
| InChI | InChI=1S/C11H19N3O3/c12-8(11(16)17)4-1-2-6-14-10(15)9-5-3-7-13-9/h7-9H,1-6,12H2,(H,14,15)(H,16,17)/t8-,9+/m0/s1 |
| InChIKey | HFVPBQOSFYXKQZ-DTWKUNHWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-[(2R)-3,4-Dihydro-2H-pyrrol-2-ylcarbonyl]-L-lysine (CHEBI:177839) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2-amino-6-[[(2R)-3,4-dihydro-2H-pyrrole-2-carbonyl]amino]hexanoic acid |