EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18N2O4 |
| Net Charge | 0 |
| Average Mass | 230.264 |
| Monoisotopic Mass | 230.12666 |
| SMILES | CC(C)[C@H](N)C(=O)N1CC(O)C[C@H]1C(=O)O |
| InChI | InChI=1S/C10H18N2O4/c1-5(2)8(11)9(14)12-4-6(13)3-7(12)10(15)16/h5-8,13H,3-4,11H2,1-2H3,(H,15,16)/t6?,7-,8-/m0/s1 |
| InChIKey | IMOKOCYUKGZZAG-ALKRTJFJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Valyl-4-hydroxyproline (CHEBI:177832) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-1-[(2S)-2-amino-3-methylbutanoyl]-4-hydroxypyrrolidine-2-carboxylic acid |