EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:177831 - 9-(3-Methyl-5-pentyl-2-furyl)nonanoic acid
| Formula | C19H32O3 |
| Net Charge | 0 |
| Average Mass | 308.462 |
| Monoisotopic Mass | 308.23514 |
| SMILES | CCCCCc1cc(C)c(CCCCCCCCC(=O)O)o1 |
| InChI | InChI=1S/C19H32O3/c1-3-4-9-12-17-15-16(2)18(22-17)13-10-7-5-6-8-11-14-19(20)21/h15H,3-14H2,1-2H3,(H,20,21) |
| InChIKey | TUQVXFOSXOCQCM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-(3-Methyl-5-pentyl-2-furyl)nonanoic acid (CHEBI:177831) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 9-(3-methyl-5-pentyluran-2-yl)nonanoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01150005 | LIPID MAPS |
| HMDB0031091 | HMDB |
| 2342093 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:57818-39-0 | ChemIDplus |