EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O4 |
| Net Charge | 0 |
| Average Mass | 358.478 |
| Monoisotopic Mass | 358.21441 |
| SMILES | COc1ccc(C[C@@H](C)[C@@H](C)Cc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C22H30O4/c1-15(11-17-7-9-19(23-3)21(13-17)25-5)16(2)12-18-8-10-20(24-4)22(14-18)26-6/h7-10,13-16H,11-12H2,1-6H3/t15-,16+ |
| InChIKey | ORQFDHFZSMXRLM-IYBDPMFKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terameprocol (CHEBI:177824) has role antineoplastic agent (CHEBI:35610) |
| terameprocol (CHEBI:177824) is a lignan (CHEBI:25036) |
| IUPAC Name |
|---|
| 4-[(2S,3R)-4-(3,4-dimethoxyphenyl)-2,3-dimethylbutyl]-1,2-dimethoxybenzene |
| INN | Source |
|---|---|
| terameprocol | WHO MedNet |
| Synonyms | Source |
|---|---|
| EM 1421 | ChEMBL |
| EM-1421 | ChEMBL |
| EM1421 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:24150-24-1 | ChemIDplus |
| Citations |
|---|