EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H37FN2O3S |
| Net Charge | 0 |
| Average Mass | 416.603 |
| Monoisotopic Mass | 416.25089 |
| SMILES | CCN(CCCCCC(C)(C)F)CCC[C@H](O)c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H37FN2O3S/c1-5-24(16-8-6-7-15-21(2,3)22)17-9-10-20(25)18-11-13-19(14-12-18)23-28(4,26)27/h11-14,20,23,25H,5-10,15-17H2,1-4H3/t20-/m0/s1 |
| InChIKey | RPQUKWBLAHJOPX-FQEVSTJZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trecetilide (CHEBI:177812) is a benzenes (CHEBI:22712) |
| Trecetilide (CHEBI:177812) is a organic amino compound (CHEBI:50047) |
| IUPAC Name |
|---|
| N-[4-[(1S)-4-[ethyl-(6-luoro-6-methylheptyl)amino]-1-hydroxybutyl]phenyl]methanesulonamide |
| Registry Numbers | Sources |
|---|---|
| CAS:180918-68-7 | ChemIDplus |