EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H52O5S2 |
| Net Charge | 0 |
| Average Mass | 616.930 |
| Monoisotopic Mass | 616.32562 |
| SMILES | CC(C)(Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)Sc1cc(C(C)(C)C)c(OC(=O)CCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C35H52O5S2/c1-31(2,3)23-17-21(18-24(29(23)39)32(4,5)6)41-35(13,14)42-22-19-25(33(7,8)9)30(26(20-22)34(10,11)12)40-28(38)16-15-27(36)37/h17-20,39H,15-16H2,1-14H3,(H,36,37) |
| InChIKey | RKSMVPNZHBRNNS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Succinobucol (CHEBI:177810) has role hypoglycemic agent (CHEBI:35526) |
| Succinobucol (CHEBI:177810) is a benzoate ester (CHEBI:36054) |
| Succinobucol (CHEBI:177810) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulanylpropan-2-ylsulanyl]phenoxy]-4-oxobutanoic acid |
| INN | Source |
|---|---|
| succinobucol | WHO MedNet |
| Synonym | Source |
|---|---|
| AGI-1067 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:216167-82-7 | ChemIDplus |
| Citations |
|---|