EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17781 - lumichrome
| Formula | C12H10N4O2 |
| Net Charge | 0 |
| Average Mass | 242.238 |
| Monoisotopic Mass | 242.08038 |
| SMILES | Cc1cc2nc3nc(=O)nc(=O)c3nc2cc1C |
| InChI | InChI=1S/C12H10N4O2/c1-5-3-7-8(4-6(5)2)14-10-9(13-7)11(17)16-12(18)15-10/h3-4H,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | ZJTJUVIJVLLGSP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lumichrome (CHEBI:17781) has functional parent alloxazine (CHEBI:37325) |
| lumichrome (CHEBI:17781) has role plant metabolite (CHEBI:76924) |
| lumichrome (CHEBI:17781) is a 7,8-dimethylbenzo[g]pteridine-2,4-dione (CHEBI:37324) |
| lumichrome (CHEBI:17781) is tautomer of 7,8-dimethylisoalloxazine (CHEBI:37323) |
| Incoming Relation(s) |
| 7,8-dimethylisoalloxazine (CHEBI:37323) is tautomer of lumichrome (CHEBI:17781) |
| IUPAC Name |
|---|
| 7,8-dimethylbenzo[g]pteridine-2,4(1H,3H)-dione |
| Synonyms | Source |
|---|---|
| 7,8-Dimethylalloxazine | KEGG COMPOUND |
| Lumichrome | KEGG COMPOUND |
| LUMICHROME | PDBeChem |
| UniProt Name | Source |
|---|---|
| lumichrome | UniProt |
| Citations |
|---|