EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H34N2O3S |
| Net Charge | 0 |
| Average Mass | 370.559 |
| Monoisotopic Mass | 370.22901 |
| SMILES | CCCCN(CCCC)CCC[C@@H](O)c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H34N2O3S/c1-4-6-14-21(15-7-5-2)16-8-9-19(22)17-10-12-18(13-11-17)20-25(3,23)24/h10-13,19-20,22H,4-9,14-16H2,1-3H3/t19-/m1/s1 |
| InChIKey | UAARDOOBGJGDJV-LJQANCHMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| artilide (CHEBI:177800) is a benzenes (CHEBI:22712) |
| artilide (CHEBI:177800) is a organic amino compound (CHEBI:50047) |
| IUPAC Name |
|---|
| N-[4-[(1R)-4-(dibutylamino)-1-hydroxybutyl]phenyl]methanesulonamide |
| Manual Xrefs | Databases |
|---|---|
| 116301 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:133267-19-3 | ChemIDplus |