EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H40N4O10 |
| Net Charge | 0 |
| Average Mass | 700.745 |
| Monoisotopic Mass | 700.27444 |
| SMILES | CC1=C(CCC(=O)O)C2=N/C1=C\c1nc(c(C)c1CCC(=O)O)CC1N=C(/C=c3\n/c(c(CC(=O)O)c3CCC(=O)O)=C\2)C(CCC(=O)O)=C1C |
| InChI | InChI=1S/C37H40N4O10/c1-17-20(4-8-33(42)43)28-14-27-19(3)22(6-10-35(46)47)30(40-27)16-32-24(12-37(50)51)23(7-11-36(48)49)31(41-32)15-29-21(5-9-34(44)45)18(2)26(39-29)13-25(17)38-28/h14-16,26,38,41H,4-13H2,1-3H3,(H,42,43)(H,44,45)(H,46,47)(H,48,49)(H,50,51)/b27-14-,31-15-,32-16- |
| InChIKey | QDDLLFZOMVJQEQ-XJTMSCLRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pentacarboxyl porphyrinogen III (CHEBI:177797) is a porphyrins (CHEBI:26214) |
| IUPAC Name |
|---|
| 3-[(10Z,15Z,19Z)-8,13,18-tris(2-carboxyethyl)-17-(carboxymethyl)-3,7,12-trimethyl-4,5,22,24-tetrahydroporphyrin-2-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 13628281 | ChemSpider |
| HMDB0001957 | HMDB |