EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38FN3O5 |
| Net Charge | 0 |
| Average Mass | 527.637 |
| Monoisotopic Mass | 527.27955 |
| SMILES | CCOc1cc2c(c(F)c1OCC)C(=N)N(CC(=O)c1cc(N3CCOCC3)c(OC)c(C(C)(C)C)c1)C2 |
| InChI | InChI=1S/C29H38FN3O5/c1-7-37-23-15-19-16-33(28(31)24(19)25(30)27(23)38-8-2)17-22(34)18-13-20(29(3,4)5)26(35-6)21(14-18)32-9-11-36-12-10-32/h13-15,31H,7-12,16-17H2,1-6H3 |
| InChIKey | QWKAUGRRIXBIPO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Atopaxar (CHEBI:177793) has role cardiovascular drug (CHEBI:35554) |
| Atopaxar (CHEBI:177793) is a aromatic ketone (CHEBI:76224) |
| IUPAC Name |
|---|
| 1-(3-tert-butyl-4-methoxy-5-morpholin-4-ylphenyl)-2-(5,6-diethoxy-4-luoro-3-imino-1H-isoindol-2-yl)ethanone |
| INN | Source |
|---|---|
| atopaxar | WHO MedNet |
| Synonyms | Source |
|---|---|
| E-5555 | ChEMBL |
| E5555 | ChEMBL |
| ER-172594-00 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:751475-53-3 | ChemIDplus |
| Citations |
|---|