EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6NO2Se |
| Net Charge | 0 |
| Average Mass | 167.046 |
| Monoisotopic Mass | 167.95637 |
| SMILES | NC(C[Se])C(=O)O |
| InChI | InChI=1S/C3H6NO2Se/c4-2(1-7)3(5)6/h2H,1,4H2,(H,5,6) |
| InChIKey | FDKWRPBBCBCIGA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2-Amino-2-carboxyethyl)selanyl (CHEBI:177792) is a α-amino acid (CHEBI:33704) |
| Manual Xrefs | Databases |
|---|---|
| 4885618 | ChemSpider |