EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4N2O2 |
| Net Charge | 0 |
| Average Mass | 136.110 |
| Monoisotopic Mass | 136.02728 |
| SMILES | C#Cc1cnc(=O)nc1=O |
| InChI | InChI=1S/C6H4N2O2/c1-2-4-3-7-6(10)8-5(4)9/h1,3H,(H2,7,8,9,10) |
| InChIKey | JOZGNYDSEBIJDH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eniluracil (CHEBI:177783) has role antineoplastic agent (CHEBI:35610) |
| eniluracil (CHEBI:177783) is a pyrimidone (CHEBI:38337) |
| Incoming Relation(s) |
| 5-ethynyl-2'-deoxyuridine (CHEBI:232486) has functional parent eniluracil (CHEBI:177783) |
| IUPAC Name |
|---|
| 5-ethynyl-1H-pyrimidine-2,4-dione |
| INN | Source |
|---|---|
| eniluracilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| 776-C-85 | ChEMBL |
| 776C85 | ChEMBL |
| Eniluracil | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:59989-18-3 | ChemIDplus |
| Citations |
|---|