EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N2O5Se |
| Net Charge | 0 |
| Average Mass | 311.196 |
| Monoisotopic Mass | 312.02244 |
| SMILES | C[Se]C[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H16N2O5Se/c1-17-4-6(9(15)16)11-7(12)3-2-5(10)8(13)14/h5-6H,2-4,10H2,1H3,(H,11,12)(H,13,14)(H,15,16)/t5-,6-/m0/s1 |
| InChIKey | IEFQLTYCECVOLL-WDSKDSINSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methylseleno Carboxyethylglutamine (CHEBI:177776) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-2-amino-5-[[(1R)-1-carboxy-2-methylselanylethyl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 19645141 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:26046-89-9 | ChemIDplus |