EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17ClN2O5 |
| Net Charge | 0 |
| Average Mass | 352.774 |
| Monoisotopic Mass | 352.08260 |
| SMILES | CCOC(=O)CC(=O)NC(Cc1cnc2cccc(Cl)c12)C(=O)O |
| InChI | InChI=1S/C16H17ClN2O5/c1-2-24-14(21)7-13(20)19-12(16(22)23)6-9-8-18-11-5-3-4-10(17)15(9)11/h3-5,8,12,18H,2,6-7H2,1H3,(H,19,20)(H,22,23) |
| InChIKey | DWVLUSJVGYOTDB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-4-Chloro-N-(3-ethoxy-1-hydroxy-3-oxopropylidene)tryptophan (CHEBI:177774) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 3-(4-chloro-1H-indol-3-yl)-2-[(3-ethoxy-3-oxopropanoyl)amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 35013189 | ChemSpider |
| HMDB0030399 | HMDB |