EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H37N5O3 |
| Net Charge | 0 |
| Average Mass | 503.647 |
| Monoisotopic Mass | 503.28964 |
| SMILES | CCc1cc(CC[C@]2(C3CCCC3)CC(O)=C(Cc3nc4nc(C)cc(C)n4n3)C(=O)O2)cc(CC)n1 |
| InChI | InChI=1S/C29H37N5O3/c1-5-22-14-20(15-23(6-2)31-22)11-12-29(21-9-7-8-10-21)17-25(35)24(27(36)37-29)16-26-32-28-30-18(3)13-19(4)34(28)33-26/h13-15,21,35H,5-12,16-17H2,1-4H3/t29-/m1/s1 |
| InChIKey | SLVAPEZTBDBAPI-GDLZYMKVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| filibuvir (CHEBI:177773) has role antiviral agent (CHEBI:22587) |
| filibuvir (CHEBI:177773) is a triazolopyrimidines (CHEBI:48435) |
| IUPAC Name |
|---|
| (2R)-2-cyclopentyl-2-[2-(2,6-diethylpyridin-4-yl)ethyl]-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4-hydroxy-3H-pyran-6-one |
| INN | Source |
|---|---|
| filibuvir | WHO MedNet |
| Synonyms | Source |
|---|---|
| PF-00868554 | ChEMBL |
| PF-868554 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:877130-28-4 | ChemIDplus |
| Citations |
|---|