EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21NS |
| Net Charge | 0 |
| Average Mass | 283.440 |
| Monoisotopic Mass | 283.13947 |
| SMILES | Cc1ccc(Sc2ccccc2C2CCNCC2)cc1 |
| InChI | InChI=1S/C18H21NS/c1-14-6-8-16(9-7-14)20-18-5-3-2-4-17(18)15-10-12-19-13-11-15/h2-9,15,19H,10-13H2,1H3 |
| InChIKey | CVASBKDYSQKLSO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tedatioxetine (CHEBI:177771) has role antidepressant (CHEBI:35469) |
| Tedatioxetine (CHEBI:177771) is a piperidines (CHEBI:26151) |
| IUPAC Name |
|---|
| 4-[2-(4-methylphenyl)sulanylphenyl]piperidine |
| INNs | Source |
|---|---|
| tedatioxetina | WHO MedNet |
| tedatioxetine | WHO MedNet |
| Synonyms | Source |
|---|---|
| LU AA24530 | ChEMBL |
| LU-AA24530 | ChEMBL |
| LUAA24530 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:508233-95-2 | ChemIDplus |