EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N4O3 |
| Net Charge | 0 |
| Average Mass | 364.405 |
| Monoisotopic Mass | 364.15354 |
| SMILES | CC(C)c1cc(-c2nnc(=O)n2-c2ccc3c(ccn3C)c2)c(O)cc1O |
| InChI | InChI=1S/C20H20N4O3/c1-11(2)14-9-15(18(26)10-17(14)25)19-21-22-20(27)24(19)13-4-5-16-12(8-13)6-7-23(16)3/h4-11,25-26H,1-3H3,(H,22,27) |
| InChIKey | RVAQIUULWULRNW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ganetespib (CHEBI:177770) has role antineoplastic agent (CHEBI:35610) |
| Ganetespib (CHEBI:177770) is a ring assembly (CHEBI:36820) |
| Ganetespib (CHEBI:177770) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| 3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(1-methylindol-5-yl)-1H-1,2,4-triazol-5-one |
| INN | Source |
|---|---|
| ganetespib | WHO MedNet |
| Synonyms | Source |
|---|---|
| STA 9090 | ChEMBL |
| STA-9090 | ChEMBL |
| Citations |
|---|