EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21NO3S |
| Net Charge | 0 |
| Average Mass | 283.393 |
| Monoisotopic Mass | 283.12421 |
| SMILES | CC(C)Cc1ccc([C@@H](C)C(=O)NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H21NO3S/c1-10(2)9-12-5-7-13(8-6-12)11(3)14(16)15-19(4,17)18/h5-8,10-11H,9H2,1-4H3,(H,15,16)/t11-/m1/s1 |
| InChIKey | KQDRVXQXKZXMHP-LLVKDONJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| reparixin (CHEBI:177765) has role antimicrobial agent (CHEBI:33281) |
| reparixin (CHEBI:177765) has role antineoplastic agent (CHEBI:35610) |
| reparixin (CHEBI:177765) has role antiviral agent (CHEBI:22587) |
| reparixin (CHEBI:177765) has role hypoglycemic agent (CHEBI:35526) |
| reparixin (CHEBI:177765) is a monoterpenoid (CHEBI:25409) |
| IUPAC Name |
|---|
| (2R)-2-[4-(2-methylpropyl)phenyl]-N-methylsulonylpropanamide |
| INNs | Source |
|---|---|
| reparixin | WHO MedNet |
| reparixina | WHO MedNet |
| reparixine | WHO MedNet |
| Synonyms | Source |
|---|---|
| DF 1681Y | ChEMBL |
| DF-1681Y | ChEMBL |
| DF1681Y | ChEMBL |
| Repertaxin | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:266359-83-5 | ChemIDplus |
| Citations |
|---|