EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N2O5P |
| Net Charge | 0 |
| Average Mass | 260.186 |
| Monoisotopic Mass | 260.05621 |
| SMILES | O=c1c2c(c1=O)N(CCP(=O)(O)O)CCCN2 |
| InChI | InChI=1S/C9H13N2O5P/c12-8-6-7(9(8)13)11(3-1-2-10-6)4-5-17(14,15)16/h10H,1-5H2,(H2,14,15,16) |
| InChIKey | BDABGOLMYNHHTR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Perzinfotel (CHEBI:177764) is a dialkylarylamine (CHEBI:23665) |
| Perzinfotel (CHEBI:177764) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-(8,9-dioxo-2,6-diazabicyclo[5.2.0]non-1(7)-en-2-yl)ethylphosphonic acid |
| Registry Numbers | Sources |
|---|---|
| CAS:144912-63-0 | ChemIDplus |