EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13FN2O4 |
| Net Charge | 0 |
| Average Mass | 244.222 |
| Monoisotopic Mass | 244.08594 |
| SMILES | Cc1cn([C@H]2C[C@H](F)[C@@H](CO)O2)c(=O)nc1=O |
| InChI | InChI=1S/C10H13FN2O4/c1-5-3-13(10(16)12-9(5)15)8-2-6(11)7(4-14)17-8/h3,6-8,14H,2,4H2,1H3,(H,12,15,16)/t6-,7+,8+/m0/s1 |
| InChIKey | UXCAQJAQSWSNPQ-XLPZGREQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Alovudine (CHEBI:177762) has role anti-HIV agent (CHEBI:64946) |
| Alovudine (CHEBI:177762) is a pyrimidine 2',3'-dideoxyribonucleoside (CHEBI:48441) |
| IUPAC Name |
|---|
| 1-[(2R,4S,5R)-4-luoro-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| INNs | Source |
|---|---|
| alovudina | WHO MedNet |
| alovudine | WHO MedNet |
| Synonyms | Source |
|---|---|
| CL 184,824 | ChEMBL |
| CL 184824 | ChEMBL |
| CL-184,824 | ChEMBL |
| CL-184824 | ChEMBL |
| MIV-310 | ChEMBL |
| MIV310 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:25526-93-6 | ChemIDplus |
| Citations |
|---|