EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25FN2O2 |
| Net Charge | 0 |
| Average Mass | 356.441 |
| Monoisotopic Mass | 356.19001 |
| SMILES | COc1ccccc1N1CCN(CCCC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H25FN2O2/c1-26-21-7-3-2-5-19(21)24-15-13-23(14-16-24)12-4-6-20(25)17-8-10-18(22)11-9-17/h2-3,5,7-11H,4,6,12-16H2,1H3 |
| InChIKey | IRYFCWPNDIUQOW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluanisone (CHEBI:177744) has role antipsychotic agent (CHEBI:35476) |
| fluanisone (CHEBI:177744) is a aromatic ketone (CHEBI:76224) |
| IUPAC Name |
|---|
| 1-(4-luorophenyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-one |
| INN | Source |
|---|---|
| fluanisona | WHO MedNet |
| Synonyms | Source |
|---|---|
| Fluanisone | ChEMBL |
| MD 2028 | ChEMBL |
| MD-2028 | ChEMBL |
| NSC-170977 | ChEMBL |
| R 2028 | ChEMBL |
| R-2028 | ChEMBL |
| Citations |
|---|