EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H22ClF3N6O3 |
| Net Charge | 0 |
| Average Mass | 546.937 |
| Monoisotopic Mass | 546.13940 |
| SMILES | Cc1ccn(-c2cc(Cl)ccc2[C@@H](Oc2cc(-c3ccc(C[C@H](N)C(=O)O)cc3)nc(N)n2)C(F)(F)F)n1 |
| InChI | InChI=1S/C25H22ClF3N6O3/c1-13-8-9-35(34-13)20-11-16(26)6-7-17(20)22(25(27,28)29)38-21-12-19(32-24(31)33-21)15-4-2-14(3-5-15)10-18(30)23(36)37/h2-9,11-12,18,22H,10,30H2,1H3,(H,36,37)(H2,31,32,33)/t18-,22+/m0/s1 |
| InChIKey | NCLGDOBQAWBXRA-PGRDOPGGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. renoprotective agent Any compound that is able to prevent damage to the kidneys. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Telotristat (CHEBI:177736) has role anti-inflammatory agent (CHEBI:67079) |
| Telotristat (CHEBI:177736) has role antineoplastic agent (CHEBI:35610) |
| Telotristat (CHEBI:177736) has role renoprotective agent (CHEBI:231911) |
| Telotristat (CHEBI:177736) is a phenylalanine derivative (CHEBI:25985) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-[4-[2-amino-6-[(1R)-1-[4-chloro-2-(3-methylpyrazol-1-yl)phenyl]-2,2,2-triluoroethoxy]pyrimidin-4-yl]phenyl]propanoic acid |
| Synonyms | Source |
|---|---|
| LP 778902 | ChEMBL |
| LP-778902 | ChEMBL |
| LX-3033 | ChEMBL |
| Telotristat | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:1033805-28-5 | ChemIDplus |
| Citations |
|---|