EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38O7S |
| Net Charge | 0 |
| Average Mass | 530.683 |
| Monoisotopic Mass | 530.23382 |
| SMILES | CCCc1c(SCCCOc2ccc(C(C)=O)c(OCCCC(=O)O)c2CCC)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C29H38O7S/c1-5-9-23-25(14-12-22(20(4)31)29(23)36-16-7-11-27(32)33)35-17-8-18-37-26-15-13-21(19(3)30)28(34)24(26)10-6-2/h12-15,34H,5-11,16-18H2,1-4H3,(H,32,33) |
| InChIKey | KPWYNAGOBXLMSE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | Sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tipelukast (CHEBI:177735) has role antifibrotic agent (CHEBI:233423) |
| Tipelukast (CHEBI:177735) is a aromatic ketone (CHEBI:76224) |
| IUPAC Name |
|---|
| 4-[6-acetyl-3-[3-(4-acetyl-3-hydroxy-2-propylphenyl)sulanylpropoxy]-2-propylphenoxy]butanoic acid |
| INN | Source |
|---|---|
| tipelukast | WHO MedNet |
| Synonyms | Source |
|---|---|
| KCA-757 | ChEMBL |
| MN-001 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:125961-82-2 | ChemIDplus |