EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H44N6O5 |
| Net Charge | 0 |
| Average Mass | 604.752 |
| Monoisotopic Mass | 604.33732 |
| SMILES | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(N)=O)NC(=O)c1ccc2ccccc2n1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C33H44N6O5/c1-21(2)19-39(32(44)38-33(3,4)5)20-28(40)26(17-22-11-7-6-8-12-22)36-31(43)27(18-29(34)41)37-30(42)25-16-15-23-13-9-10-14-24(23)35-25/h6-16,21,26-28,40H,17-20H2,1-5H3,(H2,34,41)(H,36,43)(H,37,42)(H,38,44)/t26-,27-,28+/m0/s1 |
| InChIKey | ZILOOGIOHVCEKS-HZFUHODCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Telinavir (CHEBI:177730) has role anti-HIV agent (CHEBI:64946) |
| Telinavir (CHEBI:177730) is a asparagine derivative (CHEBI:22654) |
| IUPAC Name |
|---|
| (2S)-N-[(2S,3R)-4-[tert-butylcarbamoyl(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-2-(quinoline-2-carbonylamino)butanediamide |
| INN | Source |
|---|---|
| telinavir | WHO MedNet |
| Synonyms | Source |
|---|---|
| NSC-670881 | ChEMBL |
| SC-52151 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:143224-34-4 | ChemIDplus |
| Citations |
|---|