EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H43F2N3O5 |
| Net Charge | 0 |
| Average Mass | 527.653 |
| Monoisotopic Mass | 527.31708 |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)C(F)(F)[C@@H]1O |
| InChI | InChI=1S/C27H43F2N3O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(33)36-20-21-24(34)27(28,29)25(37-21)32-19-18-22(30)31-26(32)35/h9-10,18-19,21,24-25,34H,2-8,11-17,20H2,1H3,(H2,30,31,35)/b10-9+/t21-,24-,25-/m1/s1 |
| InChIKey | HESSNRGIEVBPRB-QDDPNBLJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gemcitabine elaidate (CHEBI:177710) has role antineoplastic agent (CHEBI:35610) |
| Gemcitabine elaidate (CHEBI:177710) is a pyrimidine 2'-deoxyribonucleoside (CHEBI:19255) |
| IUPAC Name |
|---|
| [(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-diluoro-3-hydroxyoxolan-2-yl]methyl (E)-octadec-9-enoate |
| INNs | Source |
|---|---|
| elaidate de gemcitabine | WHO MedNet |
| elaidato de gemcitabina | WHO MedNet |
| gemcitabine elaidate | WHO MedNet |
| Synonyms | Source |
|---|---|
| CO-1.01 | ChEMBL |
| CO-101 | ChEMBL |
| CP-4126 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:210829-30-4 | ChemIDplus |