EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23N7O2 |
| Net Charge | 0 |
| Average Mass | 345.407 |
| Monoisotopic Mass | 345.19132 |
| SMILES | Cn1c(=O)cnn(CCCCN2CCN(c3ncccn3)CC2)c1=O |
| InChI | InChI=1S/C16H23N7O2/c1-20-14(24)13-19-23(16(20)25)8-3-2-7-21-9-11-22(12-10-21)15-17-5-4-6-18-15/h4-6,13H,2-3,7-12H2,1H3 |
| InChIKey | NMYAHEULKSYAPP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Eptapirone (CHEBI:177708) is a N-arylpiperazine (CHEBI:46848) |
| IUPAC Name |
|---|
| 4-methyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2,4-triazine-3,5-dione |
| Registry Numbers | Sources |
|---|---|
| CAS:179756-85-5 | ChemIDplus |