EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N4O5 |
| Net Charge | 0 |
| Average Mass | 272.261 |
| Monoisotopic Mass | 272.11207 |
| SMILES | C[C@H](N)C(=O)N[C@@H](CNC(=O)/C=C/C(N)=O)C(=O)O |
| InChI | InChI=1S/C10H16N4O5/c1-5(11)9(17)14-6(10(18)19)4-13-8(16)3-2-7(12)15/h2-3,5-6H,4,11H2,1H3,(H2,12,15)(H,13,16)(H,14,17)(H,18,19)/b3-2+/t5-,6-/m0/s1 |
| InChIKey | GDQNPKRTTCRUSH-KXQHVCLCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-Alanyl-3-{[(2E)-4-amino-4-oxo-2-butenoyl]amino}-L-alanine (CHEBI:177704) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-3-[[(E)-4-amino-4-oxobut-2-enoyl]amino]-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4944205 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:87768-72-7 | ChemIDplus |