EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H45N3O6 |
| Net Charge | 0 |
| Average Mass | 507.672 |
| Monoisotopic Mass | 507.33084 |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H45N3O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(31)35-20-21-24(32)25(33)26(36-21)30-19-18-22(28)29-27(30)34/h9-10,18-19,21,24-26,32-33H,2-8,11-17,20H2,1H3,(H2,28,29,34)/b10-9+/t21-,24-,25+,26-/m1/s1 |
| InChIKey | FLFGNMFWNBOBGE-FNNZEKJRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | Sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Elacytarabine (CHEBI:177700) has role antineoplastic agent (CHEBI:35610) |
| Elacytarabine (CHEBI:177700) is a pyrimidine nucleoside (CHEBI:26440) |
| IUPAC Name |
|---|
| [(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (E)-octadec-9-enoate |
| INNs | Source |
|---|---|
| elacitarabina | WHO MedNet |
| elacytarabine | WHO MedNet |
| Synonyms | Source |
|---|---|
| CP 4055 | ChEMBL |
| CP-4055 | ChEMBL |
| CP4055 | ChEMBL |
| Cytarabine eliadate | ChEMBL |
| P-4055 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:101235-34-1 | ChemIDplus |