EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O6 |
| Net Charge | 0 |
| Average Mass | 228.200 |
| Monoisotopic Mass | 228.06339 |
| SMILES | CC(C)C(=O)/C=C\C(C(=O)C(=O)O)=C(O)O |
| InChI | InChI=1S/C10H12O6/c1-5(2)7(11)4-3-6(9(13)14)8(12)10(15)16/h3-5,13-14H,1-2H3,(H,15,16)/b4-3- |
| InChIKey | XRKYEQQCLNZTAW-ARJAWSKDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4Z)-3-(Dihydroxymethylene)-7-methyl-2,6-dioxo-4-octenoic acid (CHEBI:177691) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| (Z)-3-(dihydroxymethylidene)-7-methyl-2,6-dioxooct-4-enoic acid |