EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H29NO |
| Net Charge | 0 |
| Average Mass | 251.414 |
| Monoisotopic Mass | 251.22491 |
| SMILES | [H][C@@]12CCCN1C/C(=C\[C@H](C)CCCC)C[C@]2(C)O |
| InChI | InChI=1S/C16H29NO/c1-4-5-7-13(2)10-14-11-16(3,18)15-8-6-9-17(15)12-14/h10,13,15,18H,4-9,11-12H2,1-3H3/b14-10-/t13-,15+,16+/m1/s1 |
| InChIKey | OKTQTXDNHCOLHT-AJKPHIATSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pumiliotoxin 251D (CHEBI:177689) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| (6Z,8S,8aS)-8-methyl-6-[(2R)-2-methylhexylidene]-1,2,3,5,7,8a-hexahydroindolizin-8-ol |
| Registry Numbers | Sources |
|---|---|
| CAS:73376-35-9 | ChemIDplus |