EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21N7O4S |
| Net Charge | 0 |
| Average Mass | 431.478 |
| Monoisotopic Mass | 431.13757 |
| SMILES | COc1cc2nc(N3CCN(C(=O)c4nnc(SC)o4)CC3)nc(N)c2cc1OC |
| InChI | InChI=1S/C18H21N7O4S/c1-27-12-8-10-11(9-13(12)28-2)20-17(21-14(10)19)25-6-4-24(5-7-25)16(26)15-22-23-18(29-15)30-3/h8-9H,4-7H2,1-3H3,(H2,19,20,21) |
| InChIKey | MULPYFRDYRZMDS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tiodazosin (CHEBI:177685) is a N-arylpiperazine (CHEBI:46848) |
| IUPAC Name |
|---|
| [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(5-methylsulanyl-1,3,4-oxadiazol-2-yl)methanone |
| INNs | Source |
|---|---|
| tiodazosin | WHO MedNet |
| tiodazosina | WHO MedNet |
| tiodazosine | WHO MedNet |
| Synonym | Source |
|---|---|
| BL-5111 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:66969-81-1 | ChemIDplus |