EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13N3O4 |
| Net Charge | 0 |
| Average Mass | 191.187 |
| Monoisotopic Mass | 191.09061 |
| SMILES | NC(=O)NCC(O)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H13N3O4/c7-4(5(11)12)1-3(10)2-9-6(8)13/h3-4,10H,1-2,7H2,(H,11,12)(H3,8,9,13)/t3?,4-/m0/s1 |
| InChIKey | WSFLFFUIEVIDJY-BKLSDQPFSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N5-Carbamoyl-4-hydroxy-L-ornithine (CHEBI:177672) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| (2S)-2-amino-5-(carbamoylamino)-4-hydroxypentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 75162531 | ChemSpider |