EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17765 - 2-O-(β-D-glucosyl)glycerol
| Formula | C9H18O8 |
| Net Charge | 0 |
| Average Mass | 254.235 |
| Monoisotopic Mass | 254.10017 |
| SMILES | OCC(CO)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H18O8/c10-1-4(2-11)16-9-8(15)7(14)6(13)5(3-12)17-9/h4-15H,1-3H2/t5-,6-,7+,8-,9-/m1/s1 |
| InChIKey | AQTKXCPRNZDOJU-SYHAXYEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis (ncbitaxon:3701) | |||
| - | MetaboLights (MTBLS95) | Ecotype Wassilewskija | |
| - | PubMed (24753604) | Ecotype Wassilewskija | |
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS129) | |
| Homo sapiens (ncbitaxon:9606) | |||
| blood serum (BTO:0000133) | PubMed (25598764) | ||
| blood serum (BTO:0000133) | MetaboLights (MTBLS97) |
| Roles Classification |
|---|
| Biological Roles: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-O-(β-D-glucosyl)glycerol (CHEBI:17765) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| 2-O-(β-D-glucosyl)glycerol (CHEBI:17765) has role human blood serum metabolite (CHEBI:85234) |
| 2-O-(β-D-glucosyl)glycerol (CHEBI:17765) is a glucosylglycerol (CHEBI:24287) |
| 2-O-(β-D-glucosyl)glycerol (CHEBI:17765) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 1,3-dihydroxypropan-2-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| glycerol 2-O-β-D-glucoside | ChEBI |
| β,β'-dihydroxyisopropyl β-D-glucopyranoside | ChEBI |
| lilioside B | ChEBI |
| 2-O-β-D-glucosylglycerol | ChEBI |
| 2-glyceryl β-D-glucoside | ChEBI |
| 2-(β-glucosyl)glycerol | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-O-(β-D-glucosyl)-sn-glycerol | UniProt |
| Citations |
|---|