EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9ClN2O3 |
| Net Charge | 0 |
| Average Mass | 228.635 |
| Monoisotopic Mass | 228.03017 |
| SMILES | O=C(CNC(=O)c1ccc(Cl)cc1)NO |
| InChI | InChI=1S/C9H9ClN2O3/c10-7-3-1-6(2-4-7)9(14)11-5-8(13)12-15/h1-4,15H,5H2,(H,11,14)(H,12,13) |
| InChIKey | JFZGBMJPJZDNNT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benurestat (CHEBI:177645) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| 4-chloro-N-[2-(hydroxyamino)-2-oxoethyl]benzamide |
| Registry Numbers | Sources |
|---|---|
| CAS:38274-54-3 | ChemIDplus |