EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H13O7P |
| Net Charge | 0 |
| Average Mass | 216.126 |
| Monoisotopic Mass | 216.03989 |
| SMILES | C[C@](O)(CO)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C5H13O7P/c1-5(8,3-6)4(7)2-12-13(9,10)11/h4,6-8H,2-3H2,1H3,(H2,9,10,11)/t4-,5+/m1/s1 |
| InChIKey | XMWHRVNVKDKBRG-UHNVWZDZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-C-methyl-D-erythritol 4-(dihydrogen phosphate) (CHEBI:17764) has role Escherichia coli metabolite (CHEBI:76971) |
| 2-C-methyl-D-erythritol 4-(dihydrogen phosphate) (CHEBI:17764) is a tetritol phosphate (CHEBI:26980) |
| 2-C-methyl-D-erythritol 4-(dihydrogen phosphate) (CHEBI:17764) is conjugate acid of 2-C-methyl-D-erythritol 4-phosphate(2−) (CHEBI:58262) |
| Incoming Relation(s) |
| 2-C-methyl-D-erythritol 4-phosphate(2−) (CHEBI:58262) is conjugate base of 2-C-methyl-D-erythritol 4-(dihydrogen phosphate) (CHEBI:17764) |
| IUPAC Name |
|---|
| (2R,3S)-2,3,4-trihydroxy-3-methylbutyl dihydrogen phosphate |
| Synonym | Source |
|---|---|
| 2-C-Methyl-D-erythritol 4-phosphate | KEGG COMPOUND |