EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N4O4 |
| Net Charge | 0 |
| Average Mass | 386.452 |
| Monoisotopic Mass | 386.19541 |
| SMILES | COc1cc(CNCCC2CCOCC2)ccc1Oc1cnc(C(N)=O)cn1 |
| InChI | InChI=1S/C20H26N4O4/c1-26-18-10-15(11-22-7-4-14-5-8-27-9-6-14)2-3-17(18)28-19-13-23-16(12-24-19)20(21)25/h2-3,10,12-14,22H,4-9,11H2,1H3,(H2,21,25) |
| InChIKey | ZGCYVRNZWGUXNQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | Sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bevenopran (CHEBI:177636) has role laxative (CHEBI:50503) |
| Bevenopran (CHEBI:177636) has role renoprotective agent (CHEBI:231911) |
| Bevenopran (CHEBI:177636) is a aromatic ether (CHEBI:35618) |
| IUPAC Name |
|---|
| 5-[2-methoxy-4-[[2-(oxan-4-yl)ethylamino]methyl]phenoxy]pyrazine-2-carboxamide |
| INN | Source |
|---|---|
| bevenopran | WHO MedNet |
| Synonyms | Source |
|---|---|
| ADL-5945 | ChEMBL |
| ADL5945 | ChEMBL |
| CB-5945 | ChEMBL |
| CB5-945 | ChEMBL |
| CB5945 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:676500-67-7 | ChemIDplus |