EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:177632 - 1,3,4,5-Tetrahydroxycyclohexanecarboxylic acid
| Formula | C7H12O6 |
| Net Charge | 0 |
| Average Mass | 192.167 |
| Monoisotopic Mass | 192.06339 |
| SMILES | O=C(O)C1(O)CC(O)C(O)C(O)C1 |
| InChI | InChI=1S/C7H12O6/c8-3-1-7(13,6(11)12)2-4(9)5(3)10/h3-5,8-10,13H,1-2H2,(H,11,12) |
| InChIKey | AAWZDTNXLSGCEK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3,4,5-Tetrahydroxycyclohexanecarboxylic acid (CHEBI:177632) is a quinic acid (CHEBI:26493) |
| IUPAC Name |
|---|
| 1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid |