EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H35NO3 |
| Net Charge | 0 |
| Average Mass | 433.592 |
| Monoisotopic Mass | 433.26169 |
| SMILES | [H][C@@]12CC[C@](O)(C(C)=O)[C@@]1(C)C[C@H](c1ccc(N(C)C)cc1)C1=C3CCC(=O)C=C3CC[C@]12[H] |
| InChI | InChI=1S/C28H35NO3/c1-17(30)28(32)14-13-25-23-11-7-19-15-21(31)10-12-22(19)26(23)24(16-27(25,28)2)18-5-8-20(9-6-18)29(3)4/h5-6,8-9,15,23-25,32H,7,10-14,16H2,1-4H3/t23-,24+,25-,27-,28-/m0/s1 |
| InChIKey | HKDLNTKNLJPAIY-WKWWZUSTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | Sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ulipristal (CHEBI:177631) has role antineoplastic agent (CHEBI:35610) |
| Ulipristal (CHEBI:177631) is a 20-oxo steroid (CHEBI:36885) |
| IUPAC Name |
|---|
| (8S,11R,13S,14S,17R)-17-acetyl-11-[4-(dimethylamino)phenyl]-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| Synonyms | Source |
|---|---|
| Uliprisnil | ChEMBL |
| Ulipristal | ChEMBL |
| Ulipristal acetate ulipristal | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:159811-51-5 | ChemIDplus |