EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10O4 |
| Net Charge | 0 |
| Average Mass | 218.208 |
| Monoisotopic Mass | 218.05791 |
| SMILES | CC(=O)Oc1ccc2c(C)cc(=O)oc2c1 |
| InChI | InChI=1S/C12H10O4/c1-7-5-12(14)16-11-6-9(15-8(2)13)3-4-10(7)11/h3-6H,1-2H3 |
| InChIKey | HXVZGASCDAGAPS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylumbelliferyl acetate (CHEBI:17763) has functional parent umbelliferone (CHEBI:27510) |
| 4-methylumbelliferyl acetate (CHEBI:17763) has role plant metabolite (CHEBI:76924) |
| 4-methylumbelliferyl acetate (CHEBI:17763) is a acetate ester (CHEBI:47622) |
| 4-methylumbelliferyl acetate (CHEBI:17763) is a coumarins (CHEBI:23403) |
| IUPAC Name |
|---|
| 4-methyl-2-oxo-2H-chromen-7-yl acetate |
| Synonyms | Source |
|---|---|
| 4-methyl-7-acetyloxy coumarin | ChEBI |
| 4-Methylumbelliferyl acetate | KEGG COMPOUND |
| 7-acetoxy-4-methylchromen-2-one | ChEBI |
| 7-Acetoxy-4-methylcoumarin | ChemIDplus |
| 7-(Acetyloxy)-4-methyl-2-benzopyrone | ChemIDplus |
| 7-(acetyloxy)-4-methyl-2H-1-benzopyran-2-one | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 4-methylumbelliferyl acetate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C03837 | KEGG COMPOUND |
| CPD-181 | MetaCyc |
| HMDB0032989 | HMDB |
| US2008009544 | Patent |
| WO2007107846 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:189667 | Reaxys |
| CAS:2747-05-9 | KEGG COMPOUND |
| CAS:2747-05-9 | ChemIDplus |
| Citations |
|---|