EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H33FN4O |
| Net Charge | 0 |
| Average Mass | 424.564 |
| Monoisotopic Mass | 424.26384 |
| SMILES | C[C@H]1CN(Cc2ccc(CC(=O)N3CCC(Nc4cccc(F)c4)CC3)cc2)CCN1 |
| InChI | InChI=1S/C25H33FN4O/c1-19-17-29(14-11-27-19)18-21-7-5-20(6-8-21)15-25(31)30-12-9-23(10-13-30)28-24-4-2-3-22(26)16-24/h2-8,16,19,23,27-28H,9-15,17-18H2,1H3/t19-/m0/s1 |
| InChIKey | RZKDEGZIFSJVNA-IBGZPJMESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Camicinal (CHEBI:177624) has role gastrointestinal drug (CHEBI:55324) |
| Camicinal (CHEBI:177624) is a acetamides (CHEBI:22160) |
| IUPAC Name |
|---|
| 1-[4-(3-luoroanilino)piperidin-1-yl]-2-[4-[[(3S)-3-methylpiperazin-1-yl]methyl]phenyl]ethanone |
| INN | Source |
|---|---|
| camicinal | WHO MedNet |
| Synonyms | Source |
|---|---|
| GSK-962040 | ChEMBL |
| GSK962040 | ChEMBL |
| GSK-962040B | ChEMBL |
| GSK962040B | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:923565-21-3 | ChemIDplus |
| Citations |
|---|