EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N3O5 |
| Net Charge | 0 |
| Average Mass | 245.235 |
| Monoisotopic Mass | 245.10117 |
| SMILES | NC(=O)C[C@H](N)C(=O)N1CC(O)C[C@H]1C(=O)O |
| InChI | InChI=1S/C9H15N3O5/c10-5(2-7(11)14)8(15)12-3-4(13)1-6(12)9(16)17/h4-6,13H,1-3,10H2,(H2,11,14)(H,16,17)/t4?,5-,6-/m0/s1 |
| InChIKey | LMVFAFXAMGAFOO-VZLNHYCJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asparaginyl-4-hydroxyproline (CHEBI:177623) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-1-[(2S)-2,4-diamino-4-oxobutanoyl]-4-hydroxypyrrolidine-2-carboxylic acid |