EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9N3O2 |
| Net Charge | 0 |
| Average Mass | 167.168 |
| Monoisotopic Mass | 167.06948 |
| SMILES | O=C(O)[C@@H]1Cc2ncnc2CN1 |
| InChI | InChI=1S/C7H9N3O2/c11-7(12)5-1-4-6(2-8-5)10-3-9-4/h3,5,8H,1-2H2,(H,9,10)(H,11,12)/t5-/m0/s1 |
| InChIKey | YCFJXOFFQLPCHD-YFKPBYRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | Sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spinacine (CHEBI:177618) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| (6S)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 143009 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:59981-63-4 | ChemIDplus |