EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H38N4O6 |
| Net Charge | 0 |
| Average Mass | 646.744 |
| Monoisotopic Mass | 646.27913 |
| SMILES | COc1cc2c(cc1OC)CN(CCc1ccc(NC(=O)c3cc(OC)c(OC)cc3NC(=O)c3cnc4ccccc4c3)cc1)CC2 |
| InChI | InChI=1S/C38H38N4O6/c1-45-33-18-25-14-16-42(23-28(25)19-34(33)46-2)15-13-24-9-11-29(12-10-24)40-38(44)30-20-35(47-3)36(48-4)21-32(30)41-37(43)27-17-26-7-5-6-8-31(26)39-22-27/h5-12,17-22H,13-16,23H2,1-4H3,(H,40,44)(H,41,43) |
| InChIKey | LGGHDPFKSSRQNS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tariquidar (CHEBI:177609) has role antineoplastic agent (CHEBI:35610) |
| Tariquidar (CHEBI:177609) is a benzamides (CHEBI:22702) |
| IUPAC Name |
|---|
| N-[2-[[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]carbamoyl]-4,5-dimethoxyphenyl]quinoline-3-carboxamide |
| Synonyms | Source |
|---|---|
| Tariquidar | ChEMBL |
| XR-9576 | ChEMBL |
| XR9576 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:206873-63-4 | ChemIDplus |
| Citations |
|---|