EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H25ClF3N3O2 |
| Net Charge | 0 |
| Average Mass | 515.963 |
| Monoisotopic Mass | 515.15874 |
| SMILES | C[C@H](NC(=O)C(C)(C)Oc1ccc(C(F)(F)F)cn1)[C@@H](Cc1ccc(Cl)cc1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C27H25ClF3N3O2/c1-17(34-25(35)26(2,3)36-24-12-9-21(16-33-24)27(29,30)31)23(14-18-7-10-22(28)11-8-18)20-6-4-5-19(13-20)15-32/h4-13,16-17,23H,14H2,1-3H3,(H,34,35)/t17-,23+/m0/s1 |
| InChIKey | QLYKJCMUNUWAGO-GAJHUEQPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Taranabant (CHEBI:177607) has role anti-obesity agent (CHEBI:74518) |
| Taranabant (CHEBI:177607) has role hypoglycemic agent (CHEBI:35526) |
| Taranabant (CHEBI:177607) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| N-[(2S,3S)-4-(4-chlorophenyl)-3-(3-cyanophenyl)butan-2-yl]-2-methyl-2-[5-(triluoromethyl)pyridin-2-yl]oxypropanamide |
| INN | Source |
|---|---|
| taranabant | WHO MedNet |
| Synonyms | Source |
|---|---|
| L-796568 | ChEMBL |
| Mk-0364 | ChEMBL |
| Mk0364 | ChEMBL |
| MK-0634 | ChEMBL |
| MK0634 | ChEMBL |
| Citations |
|---|