EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N2O4 |
| Net Charge | 0 |
| Average Mass | 370.449 |
| Monoisotopic Mass | 370.18926 |
| SMILES | [H][C@]12Cc3ccc(C(N)=O)c(O)c3[C@@]3(CCN1CC1CC1)CC(=O)CC[C@]32O |
| InChI | InChI=1S/C21H26N2O4/c22-19(26)15-4-3-13-9-16-21(27)6-5-14(24)10-20(21,17(13)18(15)25)7-8-23(16)11-12-1-2-12/h3-4,12,16,25,27H,1-2,5-11H2,(H2,22,26)/t16-,20-,21-/m1/s1 |
| InChIKey | RYIDHLJADOKWFM-MAODMQOUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Samidorphan (CHEBI:177605) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (1R,9R,10S)-17-(cyclopropylmethyl)-3,10-dihydroxy-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide |
| Registry Numbers | Sources |
|---|---|
| CAS:852626-89-2 | ChemIDplus |