EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28N4O4 |
| Net Charge | 0 |
| Average Mass | 436.512 |
| Monoisotopic Mass | 436.21106 |
| SMILES | COc1cccc(C(=O)Nc2ccc(OCCN3CCOCC3)c(-c3ccnn3C)c2)c1 |
| InChI | InChI=1S/C24H28N4O4/c1-27-22(8-9-25-27)21-17-19(26-24(29)18-4-3-5-20(16-18)30-2)6-7-23(21)32-15-12-28-10-13-31-14-11-28/h3-9,16-17H,10-15H2,1-2H3,(H,26,29) |
| InChIKey | ZEOQUKRCASTCFR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | Sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| temanogrel (CHEBI:177604) has role cardiovascular drug (CHEBI:35554) |
| temanogrel (CHEBI:177604) is a benzamides (CHEBI:22702) |
| IUPAC Name |
|---|
| 3-methoxy-N-[3-(2-methylpyrazol-3-yl)-4-(2-morpholin-4-ylethoxy)phenyl]benzamide |
| INN | Source |
|---|---|
| temanogrel | WHO MedNet |
| Synonyms | Source |
|---|---|
| APD-791 | ChEMBL |
| APD791 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:887936-68-7 | ChemIDplus |
| Citations |
|---|