EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H27ClO3 |
| Net Charge | 0 |
| Average Mass | 422.952 |
| Monoisotopic Mass | 422.16487 |
| SMILES | OCCOCCOc1ccc(/C(=C(/CCCl)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H27ClO3/c27-16-15-25(21-7-3-1-4-8-21)26(22-9-5-2-6-10-22)23-11-13-24(14-12-23)30-20-19-29-18-17-28/h1-14,28H,15-20H2/b26-25- |
| InChIKey | NKZTZAQIKKGTDB-QPLCGJKRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fispemifene (CHEBI:177597) has role vasodilator agent (CHEBI:35620) |
| Fispemifene (CHEBI:177597) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| 2-[2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethoxy]ethanol |
| INNs | Source |
|---|---|
| fispemifene | WHO MedNet |
| fispemifeno | WHO MedNet |
| Synonyms | Source |
|---|---|
| HM-101 | ChEMBL |
| HM-101a | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:341524-89-8 | ChemIDplus |