EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8N3O4 |
| Net Charge | +1 |
| Average Mass | 174.136 |
| Monoisotopic Mass | 174.05093 |
| SMILES | N#[N+]/C=C(\O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H7N3O4/c6-3(5(10)11)2-12-4(9)1-8-7/h1,3H,2,6H2,(H-,9,10,11)/p+1/b4-1+/t3-/m0/s1 |
| InChIKey | AGNGYMCLFWQVGX-AGFFZDDWSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-2-[(2S)-2-Amino-2-carboxyethoxy]-2-hydroxyethenediazonium (CHEBI:177591) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (E)-2-[(2S)-2-amino-2-carboxyethoxy]-2-hydroxyethenediazonium |
| Manual Xrefs | Databases |
|---|---|
| 4447427 | ChemSpider |